C21H23Br2NO4 — CID 4574563
phenyl 2-(8,9-dibromo-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl)-4-methylpentanoate (PubChem CID 4574563) has the molecular formula C21H23Br2NO4 and a molecular weight of 513.23 g/mol. Its IUPAC name is phenyl 2-(8,9-dibromo-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl)-4-methylpentanoate.
| Compound Name | phenyl 2-(8,9-dibromo-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl)-4-methylpentanoate |
|---|---|
| PubChem CID | 4574563 |
| Molecular Formula | C21H23Br2NO4 |
| Molecular Weight | 513.23 g/mol |
| Exact Mass | 511.00 |
| IUPAC Name | phenyl 2-(8,9-dibromo-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl)-4-methylpentanoate |
| SMILES | CC(C)CC(C(=O)Oc1ccccc1)N1C(=O)C2C3CC(C(Br)C3Br)C2C1=O |
| InChI | InChI=1S/C21H23Br2NO4/c1-10(2)8-14(21(27)28-11-6-4-3-5-7-11)24-19(25)15-12-9-13(16(15)20(24)26)18(23)17(12)22/h3-7,10,12-18H,8-9H2,1-2H3 |
| InChIKey | YQDIBLKFUMCQRF-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.23 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|