About 2-[(7-methyl-2-oxochromen-4-yl)methyl]-1,1-dioxo-1,2-benzothiazol-3-one
2-[(7-methyl-2-oxochromen-4-yl)methyl]-1,1-dioxo-1,2-benzothiazol-3-one (PubChem CID 4574898) has the molecular formula C18H13NO5S
and a molecular weight of 355.37 g/mol. Its IUPAC name is 2-[(7-methyl-2-oxochromen-4-yl)methyl]-1,1-dioxo-1,2-benzothiazol-3-one.
Molecular Properties
| Compound Name | 2-[(7-methyl-2-oxochromen-4-yl)methyl]-1,1-dioxo-1,2-benzothiazol-3-one |
| PubChem CID | 4574898 |
| Molecular Formula | C18H13NO5S |
| Molecular Weight | 355.37 g/mol |
| Exact Mass | 355.05 |
| IUPAC Name | 2-[(7-methyl-2-oxochromen-4-yl)methyl]-1,1-dioxo-1,2-benzothiazol-3-one |
| SMILES | Cc1ccc2c(CN3C(=O)c4ccccc4S3(=O)=O)cc(=O)oc2c1 |
| InChI | InChI=1S/C18H13NO5S/c1-11-6-7-13-12(9-17(20)24-15(13)8-11)10-19-18(21)14-4-2-3-5-16(14)25(19,22)23/h2-9H,10H2,1H3 |
| InChIKey | PXNRXCYDOJJDMK-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 84.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 355.37 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|
Analyze 2-[(7-methyl-2-oxochromen-4-yl)methyl]-1,1-dioxo-1,2-benzothiazol-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(7-methyl-2-oxochromen-4-yl)methyl]-1,1-dioxo-1,2-benzothiazol-3-one?
The IUPAC name of 2-[(7-methyl-2-oxochromen-4-yl)methyl]-1,1-dioxo-1,2-benzothiazol-3-one (CID 4574898) is 2-[(7-methyl-2-oxochromen-4-yl)methyl]-1,1-dioxo-1,2-benzothiazol-3-one.
What is the SMILES notation for 2-[(7-methyl-2-oxochromen-4-yl)methyl]-1,1-dioxo-1,2-benzothiazol-3-one?
The canonical SMILES for 2-[(7-methyl-2-oxochromen-4-yl)methyl]-1,1-dioxo-1,2-benzothiazol-3-one is Cc1ccc2c(CN3C(=O)c4ccccc4S3(=O)=O)cc(=O)oc2c1.
What is the InChIKey of 2-[(7-methyl-2-oxochromen-4-yl)methyl]-1,1-dioxo-1,2-benzothiazol-3-one?
The InChIKey is PXNRXCYDOJJDMK-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H13NO5S/c1-11-6-7-13-12(9-17(20)24-15(13)8-11)10-19-18(21)14-4-2-3-5-16(14)25(19,22)23/h2-9H,10H2,1H3.
What are the key properties of 2-[(7-methyl-2-oxochromen-4-yl)methyl]-1,1-dioxo-1,2-benzothiazol-3-one?
2-[(7-methyl-2-oxochromen-4-yl)methyl]-1,1-dioxo-1,2-benzothiazol-3-one has a molecular weight of 355.37 g/mol, XLogP of 2.45, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(7-methyl-2-oxochromen-4-yl)methyl]-1,1-dioxo-1,2-benzothiazol-3-one is sourced from PubChem (CID 4574898), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).