C13H14F5NO — CID 4575377
2,3,4,5,6-pentafluoro-N,N-di(propan-2-yl)benzamide (PubChem CID 4575377) has the molecular formula C13H14F5NO and a molecular weight of 295.25 g/mol. Its IUPAC name is 2,3,4,5,6-pentafluoro-N,N-di(propan-2-yl)benzamide.
| Compound Name | 2,3,4,5,6-pentafluoro-N,N-di(propan-2-yl)benzamide |
|---|---|
| PubChem CID | 4575377 |
| Molecular Formula | C13H14F5NO |
| Molecular Weight | 295.25 g/mol |
| Exact Mass | 295.10 |
| IUPAC Name | 2,3,4,5,6-pentafluoro-N,N-di(propan-2-yl)benzamide |
| SMILES | CC(C)N(C(=O)c1c(F)c(F)c(F)c(F)c1F)C(C)C |
| InChI | InChI=1S/C13H14F5NO/c1-5(2)19(6(3)4)13(20)7-8(14)10(16)12(18)11(17)9(7)15/h5-6H,1-4H3 |
| InChIKey | PJKBOTOGHLJRGU-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.25 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|