C22H16Cl2N2O — CID 4575566
3,5-bis(4-chlorophenyl)-1-(2-methoxyphenyl)pyrazole (PubChem CID 4575566) has the molecular formula C22H16Cl2N2O and a molecular weight of 395.29 g/mol. Its IUPAC name is 3,5-bis(4-chlorophenyl)-1-(2-methoxyphenyl)pyrazole.
| Compound Name | 3,5-bis(4-chlorophenyl)-1-(2-methoxyphenyl)pyrazole |
|---|---|
| PubChem CID | 4575566 |
| Molecular Formula | C22H16Cl2N2O |
| Molecular Weight | 395.29 g/mol |
| Exact Mass | 394.06 |
| IUPAC Name | 3,5-bis(4-chlorophenyl)-1-(2-methoxyphenyl)pyrazole |
| SMILES | COc1ccccc1-n1nc(-c2ccc(Cl)cc2)cc1-c1ccc(Cl)cc1 |
| InChI | InChI=1S/C22H16Cl2N2O/c1-27-22-5-3-2-4-20(22)26-21(16-8-12-18(24)13-9-16)14-19(25-26)15-6-10-17(23)11-7-15/h2-14H,1H3 |
| InChIKey | BRYGNFBDCJTTMP-UHFFFAOYSA-N |
| XLogP | 6.52 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.29 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |