C13H18ClN — CID 4575819
2-tert-butyl-6-chloro-7-methyl-2,3-dihydro-1H-indole (PubChem CID 4575819) has the molecular formula C13H18ClN and a molecular weight of 223.75 g/mol. Its IUPAC name is 2-tert-butyl-6-chloro-7-methyl-2,3-dihydro-1H-indole.
| Compound Name | 2-tert-butyl-6-chloro-7-methyl-2,3-dihydro-1H-indole |
|---|---|
| PubChem CID | 4575819 |
| Molecular Formula | C13H18ClN |
| Molecular Weight | 223.75 g/mol |
| Exact Mass | 223.11 |
| IUPAC Name | 2-tert-butyl-6-chloro-7-methyl-2,3-dihydro-1H-indole |
| SMILES | Cc1c(Cl)ccc2c1NC(C(C)(C)C)C2 |
| InChI | InChI=1S/C13H18ClN/c1-8-10(14)6-5-9-7-11(13(2,3)4)15-12(8)9/h5-6,11,15H,7H2,1-4H3 |
| InChIKey | SUIZKOQJHKRJOT-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.75 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |