C32H27NO7 — CID 4575844
2-(4-acetylphenyl)-6-(3-hydroxy-4-methoxyphenyl)-8-methyl-3a,4,6,11,11a,11b-hexahydronaphtho[6,7-e]isoindole-1,3,7,10-tetrone (PubChem CID 4575844) has the molecular formula C32H27NO7 and a molecular weight of 537.57 g/mol. Its IUPAC name is 2-(4-acetylphenyl)-6-(3-hydroxy-4-methoxyphenyl)-8-methyl-3a,4,6,11,11a,11b-hexahydronaphtho[6,7-e]isoindole-1,3,7,10-tetrone.
| Compound Name | 2-(4-acetylphenyl)-6-(3-hydroxy-4-methoxyphenyl)-8-methyl-3a,4,6,11,11a,11b-hexahydronaphtho[6,7-e]isoindole-1,3,7,10-tetrone |
|---|---|
| PubChem CID | 4575844 |
| Molecular Formula | C32H27NO7 |
| Molecular Weight | 537.57 g/mol |
| Exact Mass | 537.18 |
| IUPAC Name | 2-(4-acetylphenyl)-6-(3-hydroxy-4-methoxyphenyl)-8-methyl-3a,4,6,11,11a,11b-hexahydronaphtho[6,7-e]isoindole-1,3,7,10-tetrone |
| SMILES | COc1ccc(C2C3=CCC4C(=O)N(c5ccc(C(C)=O)cc5)C(=O)C4C3CC3=C2C(=O)C(C)=CC3=O)cc1O |
| InChI | InChI=1S/C32H27NO7/c1-15-12-24(35)23-14-22-20(27(29(23)30(15)37)18-6-11-26(40-3)25(36)13-18)9-10-21-28(22)32(39)33(31(21)38)19-7-4-17(5-8-19)16(2)34/h4-9,11-13,21-22,27-28,36H,10,14H2,1-3H3 |
| InChIKey | IQCZGNGKBCJSGJ-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 118.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.57 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|