C16H14ClN — CID 4576282
(5-chloro-2-tricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,9,11,13-heptaenyl)methanamine (PubChem CID 4576282) has the molecular formula C16H14ClN and a molecular weight of 255.75 g/mol. Its IUPAC name is (5-chloro-2-tricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,9,11,13-heptaenyl)methanamine.
| Compound Name | (5-chloro-2-tricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,9,11,13-heptaenyl)methanamine |
|---|---|
| PubChem CID | 4576282 |
| Molecular Formula | C16H14ClN |
| Molecular Weight | 255.75 g/mol |
| Exact Mass | 255.08 |
| IUPAC Name | (5-chloro-2-tricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,9,11,13-heptaenyl)methanamine |
| SMILES | NCC1c2ccccc2C=Cc2ccc(Cl)cc21 |
| InChI | InChI=1S/C16H14ClN/c17-13-8-7-12-6-5-11-3-1-2-4-14(11)16(10-18)15(12)9-13/h1-9,16H,10,18H2 |
| InChIKey | QCWCAHQGBJXAGH-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.75 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|