C22H24BrClN6OS — CID 4576283
4-bromo-7-(2-chlorophenyl)-13-[4-(2-ethoxyethyl)piperazin-1-yl]-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaene (PubChem CID 4576283) has the molecular formula C22H24BrClN6OS and a molecular weight of 535.90 g/mol. Its IUPAC name is 4-bromo-7-(2-chlorophenyl)-13-[4-(2-ethoxyethyl)piperazin-1-yl]-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaene.
| Compound Name | 4-bromo-7-(2-chlorophenyl)-13-[4-(2-ethoxyethyl)piperazin-1-yl]-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaene |
|---|---|
| PubChem CID | 4576283 |
| Molecular Formula | C22H24BrClN6OS |
| Molecular Weight | 535.90 g/mol |
| Exact Mass | 534.06 |
| IUPAC Name | 4-bromo-7-(2-chlorophenyl)-13-[4-(2-ethoxyethyl)piperazin-1-yl]-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaene |
| SMILES | CCOCCN1CCN(c2nnc3n2-c2sc(Br)cc2C(c2ccccc2Cl)=NC3)CC1 |
| InChI | InChI=1S/C22H24BrClN6OS/c1-2-31-12-11-28-7-9-29(10-8-28)22-27-26-19-14-25-20(15-5-3-4-6-17(15)24)16-13-18(23)32-21(16)30(19)22/h3-6,13H,2,7-12,14H2,1H3 |
| InChIKey | UBZUMZVDCSFGGP-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 58.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.90 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|