About 1-(imidazo[1,2-a]pyridin-2-ylmethylsulfanyl)phthalazine
1-(imidazo[1,2-a]pyridin-2-ylmethylsulfanyl)phthalazine (PubChem CID 4577500) has the molecular formula C16H12N4S
and a molecular weight of 292.37 g/mol. Its IUPAC name is 1-(imidazo[1,2-a]pyridin-2-ylmethylsulfanyl)phthalazine.
Molecular Properties
| Compound Name | 1-(imidazo[1,2-a]pyridin-2-ylmethylsulfanyl)phthalazine |
| PubChem CID | 4577500 |
| Molecular Formula | C16H12N4S |
| Molecular Weight | 292.37 g/mol |
| Exact Mass | 292.08 |
| IUPAC Name | 1-(imidazo[1,2-a]pyridin-2-ylmethylsulfanyl)phthalazine |
| SMILES | c1ccc2c(SCc3cn4ccccc4n3)nncc2c1 |
| InChI | InChI=1S/C16H12N4S/c1-2-6-14-12(5-1)9-17-19-16(14)21-11-13-10-20-8-4-3-7-15(20)18-13/h1-10H,11H2 |
| InChIKey | VXWBHULTISEDLA-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 43.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.37 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-(imidazo[1,2-a]pyridin-2-ylmethylsulfanyl)phthalazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(imidazo[1,2-a]pyridin-2-ylmethylsulfanyl)phthalazine?
The IUPAC name of 1-(imidazo[1,2-a]pyridin-2-ylmethylsulfanyl)phthalazine (CID 4577500) is 1-(imidazo[1,2-a]pyridin-2-ylmethylsulfanyl)phthalazine.
What is the SMILES notation for 1-(imidazo[1,2-a]pyridin-2-ylmethylsulfanyl)phthalazine?
The canonical SMILES for 1-(imidazo[1,2-a]pyridin-2-ylmethylsulfanyl)phthalazine is c1ccc2c(SCc3cn4ccccc4n3)nncc2c1.
What is the InChIKey of 1-(imidazo[1,2-a]pyridin-2-ylmethylsulfanyl)phthalazine?
The InChIKey is VXWBHULTISEDLA-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H12N4S/c1-2-6-14-12(5-1)9-17-19-16(14)21-11-13-10-20-8-4-3-7-15(20)18-13/h1-10H,11H2.
What are the key properties of 1-(imidazo[1,2-a]pyridin-2-ylmethylsulfanyl)phthalazine?
1-(imidazo[1,2-a]pyridin-2-ylmethylsulfanyl)phthalazine has a molecular weight of 292.37 g/mol, XLogP of 3.57, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(imidazo[1,2-a]pyridin-2-ylmethylsulfanyl)phthalazine is sourced from PubChem (CID 4577500), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).