C33H26Cl3N3O7 — CID 4577528
6-(5-chloro-2-hydroxyphenyl)-8-(2,4-dichloroanilino)-2-hydroxy-6a-(4-methoxyphenyl)-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-1,3,7,9-tetrone (PubChem CID 4577528) has the molecular formula C33H26Cl3N3O7 and a molecular weight of 682.94 g/mol. Its IUPAC name is 6-(5-chloro-2-hydroxyphenyl)-8-(2,4-dichloroanilino)-2-hydroxy-6a-(4-methoxyphenyl)-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-1,3,7,9-tetrone.
| Compound Name | 6-(5-chloro-2-hydroxyphenyl)-8-(2,4-dichloroanilino)-2-hydroxy-6a-(4-methoxyphenyl)-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-1,3,7,9-tetrone |
|---|---|
| PubChem CID | 4577528 |
| Molecular Formula | C33H26Cl3N3O7 |
| Molecular Weight | 682.94 g/mol |
| Exact Mass | 681.08 |
| IUPAC Name | 6-(5-chloro-2-hydroxyphenyl)-8-(2,4-dichloroanilino)-2-hydroxy-6a-(4-methoxyphenyl)-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-1,3,7,9-tetrone |
| SMILES | COc1ccc(C23C(=O)N(Nc4ccc(Cl)cc4Cl)C(=O)C2CC2C(=CCC4C(=O)N(O)C(=O)C42)C3c2cc(Cl)ccc2O)cc1 |
| InChI | InChI=1S/C33H26Cl3N3O7/c1-46-18-6-2-15(3-7-18)33-23(30(42)38(32(33)44)37-25-10-4-17(35)13-24(25)36)14-21-19(28(33)22-12-16(34)5-11-26(22)40)8-9-20-27(21)31(43)39(45)29(20)41/h2-8,10-13,20-21,23,27-28,37,40,45H,9,14H2,1H3 |
| InChIKey | HRDAFERQEBIMFB-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 136.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 682.94 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|