C18H16F5N5O — CID 4577554
N-[3,5-dimethyl-1-[(2,3,4,5,6-pentafluorophenyl)methyl]pyrazol-4-yl]-1-ethylpyrazole-3-carboxamide (PubChem CID 4577554) has the molecular formula C18H16F5N5O and a molecular weight of 413.35 g/mol. Its IUPAC name is N-[3,5-dimethyl-1-[(2,3,4,5,6-pentafluorophenyl)methyl]pyrazol-4-yl]-1-ethylpyrazole-3-carboxamide.
| Compound Name | N-[3,5-dimethyl-1-[(2,3,4,5,6-pentafluorophenyl)methyl]pyrazol-4-yl]-1-ethylpyrazole-3-carboxamide |
|---|---|
| PubChem CID | 4577554 |
| Molecular Formula | C18H16F5N5O |
| Molecular Weight | 413.35 g/mol |
| Exact Mass | 413.13 |
| IUPAC Name | N-[3,5-dimethyl-1-[(2,3,4,5,6-pentafluorophenyl)methyl]pyrazol-4-yl]-1-ethylpyrazole-3-carboxamide |
| SMILES | CCn1ccc(C(=O)Nc2c(C)nn(Cc3c(F)c(F)c(F)c(F)c3F)c2C)n1 |
| InChI | InChI=1S/C18H16F5N5O/c1-4-27-6-5-11(26-27)18(29)24-17-8(2)25-28(9(17)3)7-10-12(19)14(21)16(23)15(22)13(10)20/h5-6H,4,7H2,1-3H3,(H,24,29) |
| InChIKey | CYIZPOJPNYZQPP-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 64.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.35 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|