C35H56O10 — CID 4577626
2-[[3,4-dihydroxy-22-(2-hydroxypropan-2-yl)-1,5,10,10-tetramethyl-21,25-dioxaheptacyclo[20.2.1.02,19.05,19.06,16.09,14.014,16]pentacosan-11-yl]oxy]oxane-3,4,5-triol (PubChem CID 4577626) has the molecular formula C35H56O10 and a molecular weight of 636.82 g/mol. Its IUPAC name is 2-[[3,4-dihydroxy-22-(2-hydroxypropan-2-yl)-1,5,10,10-tetramethyl-21,25-dioxaheptacyclo[20.2.1.02,19.05,19.06,16.09,14.014,16]pentacosan-11-yl]oxy]oxane-3,4,5-triol.
| Compound Name | 2-[[3,4-dihydroxy-22-(2-hydroxypropan-2-yl)-1,5,10,10-tetramethyl-21,25-dioxaheptacyclo[20.2.1.02,19.05,19.06,16.09,14.014,16]pentacosan-11-yl]oxy]oxane-3,4,5-triol |
|---|---|
| PubChem CID | 4577626 |
| Molecular Formula | C35H56O10 |
| Molecular Weight | 636.82 g/mol |
| Exact Mass | 636.39 |
| IUPAC Name | 2-[[3,4-dihydroxy-22-(2-hydroxypropan-2-yl)-1,5,10,10-tetramethyl-21,25-dioxaheptacyclo[20.2.1.02,19.05,19.06,16.09,14.014,16]pentacosan-11-yl]oxy]oxane-3,4,5-triol |
| SMILES | CC12CCC(C(C)(C)O)(OCC34CCC56CC57CCC(OC5OCC(O)C(O)C5O)C(C)(C)C7CCC6C3(C)C(O)C(O)C14)O2 |
| InChI | InChI=1S/C35H56O10/c1-28(2)19-7-8-20-31(6)26(40)24(39)25-30(5)11-14-35(45-30,29(3,4)41)43-17-34(25,31)13-12-33(20)16-32(19,33)10-9-21(28)44-27-23(38)22(37)18(36)15-42-27/h18-27,36-41H,7-17H2,1-6H3 |
| InChIKey | AWNMTBBVPSHMGC-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 158.30 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.82 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'saponine_derivative', 'substructure': 'N/A'} |
|---|