C38H36N2O7 — CID 4577703
6-[2-(4-hydroxy-3-methoxyphenyl)ethenyl]-2-[2-(4-hydroxyphenyl)ethyl]-6a-methyl-8-phenyl-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-1,3,7,9-tetrone (PubChem CID 4577703) has the molecular formula C38H36N2O7 and a molecular weight of 632.71 g/mol. Its IUPAC name is 6-[2-(4-hydroxy-3-methoxyphenyl)ethenyl]-2-[2-(4-hydroxyphenyl)ethyl]-6a-methyl-8-phenyl-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-1,3,7,9-tetrone.
| Compound Name | 6-[2-(4-hydroxy-3-methoxyphenyl)ethenyl]-2-[2-(4-hydroxyphenyl)ethyl]-6a-methyl-8-phenyl-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-1,3,7,9-tetrone |
|---|---|
| PubChem CID | 4577703 |
| Molecular Formula | C38H36N2O7 |
| Molecular Weight | 632.71 g/mol |
| Exact Mass | 632.25 |
| IUPAC Name | 6-[2-(4-hydroxy-3-methoxyphenyl)ethenyl]-2-[2-(4-hydroxyphenyl)ethyl]-6a-methyl-8-phenyl-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-1,3,7,9-tetrone |
| SMILES | COc1cc(C=CC2C3=CCC4C(=O)N(CCc5ccc(O)cc5)C(=O)C4C3CC3C(=O)N(c4ccccc4)C(=O)C23C)ccc1O |
| InChI | InChI=1S/C38H36N2O7/c1-38-29(16-10-23-11-17-31(42)32(20-23)47-2)26-14-15-27-33(36(45)39(34(27)43)19-18-22-8-12-25(41)13-9-22)28(26)21-30(38)35(44)40(37(38)46)24-6-4-3-5-7-24/h3-14,16-17,20,27-30,33,41-42H,15,18-19,21H2,1-2H3 |
| InChIKey | WJPSIYANVMUHME-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 124.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.71 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|