C6Cl4I2 — CID 4578136
1,2,4,5-tetrachloro-3,6-diiodobenzene (PubChem CID 4578136) has the molecular formula C6Cl4I2 and a molecular weight of 467.69 g/mol. Its IUPAC name is 1,2,4,5-tetrachloro-3,6-diiodobenzene.
| Compound Name | 1,2,4,5-tetrachloro-3,6-diiodobenzene |
|---|---|
| PubChem CID | 4578136 |
| Molecular Formula | C6Cl4I2 |
| Molecular Weight | 467.69 g/mol |
| Exact Mass | 465.68 |
| IUPAC Name | 1,2,4,5-tetrachloro-3,6-diiodobenzene |
| SMILES | Clc1c(Cl)c(I)c(Cl)c(Cl)c1I |
| InChI | InChI=1S/C6Cl4I2/c7-1-2(8)6(12)4(10)3(9)5(1)11 |
| InChIKey | XJVBNWIBATXUFC-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.69 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|