C21H32N4O2S — CID 4578691
3-[(3-benzyl-1,2,4-thiadiazol-5-yl)-(2-methoxyethyl)amino]-N-hexylpropanamide (PubChem CID 4578691) has the molecular formula C21H32N4O2S and a molecular weight of 404.58 g/mol. Its IUPAC name is 3-[(3-benzyl-1,2,4-thiadiazol-5-yl)-(2-methoxyethyl)amino]-N-hexylpropanamide.
| Compound Name | 3-[(3-benzyl-1,2,4-thiadiazol-5-yl)-(2-methoxyethyl)amino]-N-hexylpropanamide |
|---|---|
| PubChem CID | 4578691 |
| Molecular Formula | C21H32N4O2S |
| Molecular Weight | 404.58 g/mol |
| Exact Mass | 404.22 |
| IUPAC Name | 3-[(3-benzyl-1,2,4-thiadiazol-5-yl)-(2-methoxyethyl)amino]-N-hexylpropanamide |
| SMILES | CCCCCCNC(=O)CCN(CCOC)c1nc(Cc2ccccc2)ns1 |
| InChI | InChI=1S/C21H32N4O2S/c1-3-4-5-9-13-22-20(26)12-14-25(15-16-27-2)21-23-19(24-28-21)17-18-10-7-6-8-11-18/h6-8,10-11H,3-5,9,12-17H2,1-2H3,(H,22,26) |
| InChIKey | KQYOFMGRQPQLSG-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.58 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|