C21H17F5OSi — CID 4581060
benzhydryloxy-dimethyl-(2,3,4,5,6-pentafluorophenyl)silane (PubChem CID 4581060) has the molecular formula C21H17F5OSi and a molecular weight of 408.44 g/mol. Its IUPAC name is benzhydryloxy-dimethyl-(2,3,4,5,6-pentafluorophenyl)silane.
| Compound Name | benzhydryloxy-dimethyl-(2,3,4,5,6-pentafluorophenyl)silane |
|---|---|
| PubChem CID | 4581060 |
| Molecular Formula | C21H17F5OSi |
| Molecular Weight | 408.44 g/mol |
| Exact Mass | 408.10 |
| IUPAC Name | benzhydryloxy-dimethyl-(2,3,4,5,6-pentafluorophenyl)silane |
| SMILES | C[Si](C)(OC(c1ccccc1)c1ccccc1)c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C21H17F5OSi/c1-28(2,21-18(25)16(23)15(22)17(24)19(21)26)27-20(13-9-5-3-6-10-13)14-11-7-4-8-12-14/h3-12,20H,1-2H3 |
| InChIKey | MWWJOEPBXAPOCZ-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.44 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|