C21H24ClFN5+3 — CID 4581999
1-(4-chlorophenyl)-N-[(3-fluorophenyl)methylideneamino]-1-(1,3,5-triazoniatricyclo[3.3.1.13,7]decan-7-yl)methanimine (PubChem CID 4581999) has the molecular formula C21H24ClFN5+3 and a molecular weight of 400.91 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-N-[(3-fluorophenyl)methylideneamino]-1-(1,3,5-triazoniatricyclo[3.3.1.13,7]decan-7-yl)methanimine.
| Compound Name | 1-(4-chlorophenyl)-N-[(3-fluorophenyl)methylideneamino]-1-(1,3,5-triazoniatricyclo[3.3.1.13,7]decan-7-yl)methanimine |
|---|---|
| PubChem CID | 4581999 |
| Molecular Formula | C21H24ClFN5+3 |
| Molecular Weight | 400.91 g/mol |
| Exact Mass | 400.17 |
| IUPAC Name | 1-(4-chlorophenyl)-N-[(3-fluorophenyl)methylideneamino]-1-(1,3,5-triazoniatricyclo[3.3.1.13,7]decan-7-yl)methanimine |
| SMILES | Fc1cccc(C=NN=C(c2ccc(Cl)cc2)C23C[NH+]4C[NH+](C[NH+](C4)C2)C3)c1 |
| InChI | InChI=1S/C21H21ClFN5/c22-18-6-4-17(5-7-18)20(25-24-9-16-2-1-3-19(23)8-16)21-10-26-13-27(11-21)15-28(12-21)14-26/h1-9H,10-15H2/p+3 |
| InChIKey | CQYMILQEXCRWGD-UHFFFAOYSA-Q |
| XLogP | -1.14 |
| TPSA | 38.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.91 |
| LogP ≤ 5 | -1.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|