About N-(3,4,6-trichloro-2-nitrophenyl)acetamide
N-(3,4,6-trichloro-2-nitrophenyl)acetamide (PubChem CID 4582781) has the molecular formula C8H5Cl3N2O3
and a molecular weight of 283.50 g/mol. Its IUPAC name is N-(3,4,6-trichloro-2-nitrophenyl)acetamide.
Molecular Properties
| Compound Name | N-(3,4,6-trichloro-2-nitrophenyl)acetamide |
| PubChem CID | 4582781 |
| Molecular Formula | C8H5Cl3N2O3 |
| Molecular Weight | 283.50 g/mol |
| Exact Mass | 281.94 |
| IUPAC Name | N-(3,4,6-trichloro-2-nitrophenyl)acetamide |
| SMILES | CC(=O)Nc1c(Cl)cc(Cl)c(Cl)c1[N+](=O)[O-] |
| InChI | InChI=1S/C8H5Cl3N2O3/c1-3(14)12-7-5(10)2-4(9)6(11)8(7)13(15)16/h2H,1H3,(H,12,14) |
| InChIKey | DLGBJVCWDXYHMM-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 72.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.50 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-(3,4,6-trichloro-2-nitrophenyl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3,4,6-trichloro-2-nitrophenyl)acetamide?
The IUPAC name of N-(3,4,6-trichloro-2-nitrophenyl)acetamide (CID 4582781) is N-(3,4,6-trichloro-2-nitrophenyl)acetamide.
What is the SMILES notation for N-(3,4,6-trichloro-2-nitrophenyl)acetamide?
The canonical SMILES for N-(3,4,6-trichloro-2-nitrophenyl)acetamide is CC(=O)Nc1c(Cl)cc(Cl)c(Cl)c1[N+](=O)[O-].
What is the InChIKey of N-(3,4,6-trichloro-2-nitrophenyl)acetamide?
The InChIKey is DLGBJVCWDXYHMM-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H5Cl3N2O3/c1-3(14)12-7-5(10)2-4(9)6(11)8(7)13(15)16/h2H,1H3,(H,12,14).
What are the key properties of N-(3,4,6-trichloro-2-nitrophenyl)acetamide?
N-(3,4,6-trichloro-2-nitrophenyl)acetamide has a molecular weight of 283.50 g/mol, XLogP of 3.51, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3,4,6-trichloro-2-nitrophenyl)acetamide is sourced from PubChem (CID 4582781), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).