About (4-tert-butylcyclohexyl) 2-(1-methylpiperidin-1-ium-1-yl)acetate
(4-tert-butylcyclohexyl) 2-(1-methylpiperidin-1-ium-1-yl)acetate (PubChem CID 4583712) has the molecular formula C18H34NO2+
and a molecular weight of 296.47 g/mol. Its IUPAC name is (4-tert-butylcyclohexyl) 2-(1-methylpiperidin-1-ium-1-yl)acetate.
Molecular Properties
| Compound Name | (4-tert-butylcyclohexyl) 2-(1-methylpiperidin-1-ium-1-yl)acetate |
| PubChem CID | 4583712 |
| Molecular Formula | C18H34NO2+ |
| Molecular Weight | 296.47 g/mol |
| Exact Mass | 296.26 |
| IUPAC Name | (4-tert-butylcyclohexyl) 2-(1-methylpiperidin-1-ium-1-yl)acetate |
| SMILES | CC(C)(C)C1CCC(OC(=O)C[N+]2(C)CCCCC2)CC1 |
| InChI | InChI=1S/C18H34NO2/c1-18(2,3)15-8-10-16(11-9-15)21-17(20)14-19(4)12-6-5-7-13-19/h15-16H,5-14H2,1-4H3/q+1 |
| InChIKey | RLKXIXDLHTWHEY-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 296.47 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze (4-tert-butylcyclohexyl) 2-(1-methylpiperidin-1-ium-1-yl)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-tert-butylcyclohexyl) 2-(1-methylpiperidin-1-ium-1-yl)acetate?
The IUPAC name of (4-tert-butylcyclohexyl) 2-(1-methylpiperidin-1-ium-1-yl)acetate (CID 4583712) is (4-tert-butylcyclohexyl) 2-(1-methylpiperidin-1-ium-1-yl)acetate.
What is the SMILES notation for (4-tert-butylcyclohexyl) 2-(1-methylpiperidin-1-ium-1-yl)acetate?
The canonical SMILES for (4-tert-butylcyclohexyl) 2-(1-methylpiperidin-1-ium-1-yl)acetate is CC(C)(C)C1CCC(OC(=O)C[N+]2(C)CCCCC2)CC1.
What is the InChIKey of (4-tert-butylcyclohexyl) 2-(1-methylpiperidin-1-ium-1-yl)acetate?
The InChIKey is RLKXIXDLHTWHEY-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H34NO2/c1-18(2,3)15-8-10-16(11-9-15)21-17(20)14-19(4)12-6-5-7-13-19/h15-16H,5-14H2,1-4H3/q+1.
What are the key properties of (4-tert-butylcyclohexyl) 2-(1-methylpiperidin-1-ium-1-yl)acetate?
(4-tert-butylcyclohexyl) 2-(1-methylpiperidin-1-ium-1-yl)acetate has a molecular weight of 296.47 g/mol, XLogP of 3.77, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4-tert-butylcyclohexyl) 2-(1-methylpiperidin-1-ium-1-yl)acetate is sourced from PubChem (CID 4583712), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).