C22H18Br2N4O5 — CID 4583740
2-N,5-N-bis[(2-bromo-5-methoxyphenyl)methylideneamino]furan-2,5-dicarboxamide (PubChem CID 4583740) has the molecular formula C22H18Br2N4O5 and a molecular weight of 578.22 g/mol. Its IUPAC name is 2-N,5-N-bis[(2-bromo-5-methoxyphenyl)methylideneamino]furan-2,5-dicarboxamide.
| Compound Name | 2-N,5-N-bis[(2-bromo-5-methoxyphenyl)methylideneamino]furan-2,5-dicarboxamide |
|---|---|
| PubChem CID | 4583740 |
| Molecular Formula | C22H18Br2N4O5 |
| Molecular Weight | 578.22 g/mol |
| Exact Mass | 575.96 |
| IUPAC Name | 2-N,5-N-bis[(2-bromo-5-methoxyphenyl)methylideneamino]furan-2,5-dicarboxamide |
| SMILES | COc1ccc(Br)c(C=NNC(=O)c2ccc(C(=O)NN=Cc3cc(OC)ccc3Br)o2)c1 |
| InChI | InChI=1S/C22H18Br2N4O5/c1-31-15-3-5-17(23)13(9-15)11-25-27-21(29)19-7-8-20(33-19)22(30)28-26-12-14-10-16(32-2)4-6-18(14)24/h3-12H,1-2H3,(H,27,29)(H,28,30) |
| InChIKey | MMDBTIFXPLEJPE-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 114.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.22 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|