C16H14N4O2 — CID 4583812
6-[2-(benzylamino)phenyl]-2H-1,2,4-triazine-3,5-dione (PubChem CID 4583812) has the molecular formula C16H14N4O2 and a molecular weight of 294.31 g/mol. Its IUPAC name is 6-[2-(benzylamino)phenyl]-2H-1,2,4-triazine-3,5-dione.
| Compound Name | 6-[2-(benzylamino)phenyl]-2H-1,2,4-triazine-3,5-dione |
|---|---|
| PubChem CID | 4583812 |
| Molecular Formula | C16H14N4O2 |
| Molecular Weight | 294.31 g/mol |
| Exact Mass | 294.11 |
| IUPAC Name | 6-[2-(benzylamino)phenyl]-2H-1,2,4-triazine-3,5-dione |
| SMILES | O=c1[nH]nc(-c2ccccc2NCc2ccccc2)c(=O)[nH]1 |
| InChI | InChI=1S/C16H14N4O2/c21-15-14(19-20-16(22)18-15)12-8-4-5-9-13(12)17-10-11-6-2-1-3-7-11/h1-9,17H,10H2,(H2,18,20,21,22) |
| InChIKey | KPTFDOZWHRQCMN-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 90.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.31 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |