About N-[2,3-dimethylbutan-2-yl(dimethyl)silyl]-N-methylmethanamine
N-[2,3-dimethylbutan-2-yl(dimethyl)silyl]-N-methylmethanamine (PubChem CID 4584006) has the molecular formula C10H25NSi
and a molecular weight of 187.40 g/mol. Its IUPAC name is N-[2,3-dimethylbutan-2-yl(dimethyl)silyl]-N-methylmethanamine.
Molecular Properties
| Compound Name | N-[2,3-dimethylbutan-2-yl(dimethyl)silyl]-N-methylmethanamine |
| PubChem CID | 4584006 |
| Molecular Formula | C10H25NSi |
| Molecular Weight | 187.40 g/mol |
| Exact Mass | 187.18 |
| IUPAC Name | N-[2,3-dimethylbutan-2-yl(dimethyl)silyl]-N-methylmethanamine |
| SMILES | CC(C)C(C)(C)[Si](C)(C)N(C)C |
| InChI | InChI=1S/C10H25NSi/c1-9(2)10(3,4)12(7,8)11(5)6/h9H,1-8H3 |
| InChIKey | MAEITZRAZRCOLG-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.40 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze N-[2,3-dimethylbutan-2-yl(dimethyl)silyl]-N-methylmethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2,3-dimethylbutan-2-yl(dimethyl)silyl]-N-methylmethanamine?
The IUPAC name of N-[2,3-dimethylbutan-2-yl(dimethyl)silyl]-N-methylmethanamine (CID 4584006) is N-[2,3-dimethylbutan-2-yl(dimethyl)silyl]-N-methylmethanamine.
What is the SMILES notation for N-[2,3-dimethylbutan-2-yl(dimethyl)silyl]-N-methylmethanamine?
The canonical SMILES for N-[2,3-dimethylbutan-2-yl(dimethyl)silyl]-N-methylmethanamine is CC(C)C(C)(C)[Si](C)(C)N(C)C.
What is the InChIKey of N-[2,3-dimethylbutan-2-yl(dimethyl)silyl]-N-methylmethanamine?
The InChIKey is MAEITZRAZRCOLG-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H25NSi/c1-9(2)10(3,4)12(7,8)11(5)6/h9H,1-8H3.
What are the key properties of N-[2,3-dimethylbutan-2-yl(dimethyl)silyl]-N-methylmethanamine?
N-[2,3-dimethylbutan-2-yl(dimethyl)silyl]-N-methylmethanamine has a molecular weight of 187.40 g/mol, XLogP of 3.19, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2,3-dimethylbutan-2-yl(dimethyl)silyl]-N-methylmethanamine is sourced from PubChem (CID 4584006), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).