C22H24N6O6 — CID 4584943
ethyl 4-[3-[(1,3-dimethyl-2,4,6-trioxo-1,3-diazinan-5-ylidene)methyl]-4-oxopyrido[1,2-a]pyrimidin-2-yl]piperazine-1-carboxylate (PubChem CID 4584943) has the molecular formula C22H24N6O6 and a molecular weight of 468.47 g/mol. Its IUPAC name is ethyl 4-[3-[(1,3-dimethyl-2,4,6-trioxo-1,3-diazinan-5-ylidene)methyl]-4-oxopyrido[1,2-a]pyrimidin-2-yl]piperazine-1-carboxylate.
| Compound Name | ethyl 4-[3-[(1,3-dimethyl-2,4,6-trioxo-1,3-diazinan-5-ylidene)methyl]-4-oxopyrido[1,2-a]pyrimidin-2-yl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 4584943 |
| Molecular Formula | C22H24N6O6 |
| Molecular Weight | 468.47 g/mol |
| Exact Mass | 468.18 |
| IUPAC Name | ethyl 4-[3-[(1,3-dimethyl-2,4,6-trioxo-1,3-diazinan-5-ylidene)methyl]-4-oxopyrido[1,2-a]pyrimidin-2-yl]piperazine-1-carboxylate |
| SMILES | CCOC(=O)N1CCN(c2nc3ccccn3c(=O)c2C=C2C(=O)N(C)C(=O)N(C)C2=O)CC1 |
| InChI | InChI=1S/C22H24N6O6/c1-4-34-22(33)27-11-9-26(10-12-27)17-14(20(31)28-8-6-5-7-16(28)23-17)13-15-18(29)24(2)21(32)25(3)19(15)30/h5-8,13H,4,9-12H2,1-3H3 |
| InChIKey | BDGRTZPPHBOGRQ-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 124.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.47 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|