About bis(N-methylcarbamodithioate);nickel(2+)
bis(N-methylcarbamodithioate);nickel(2+) (PubChem CID 4585014) has the molecular formula C4H8N2NiS4
and a molecular weight of 271.08 g/mol. Its IUPAC name is bis(N-methylcarbamodithioate);nickel(2+).
Molecular Properties
| Compound Name | bis(N-methylcarbamodithioate);nickel(2+) |
| PubChem CID | 4585014 |
| Molecular Formula | C4H8N2NiS4 |
| Molecular Weight | 271.08 g/mol |
| Exact Mass | 269.89 |
| IUPAC Name | bis(N-methylcarbamodithioate);nickel(2+) |
| SMILES | CNC(=S)[S-].CNC(=S)[S-].[Ni+2] |
| InChI | InChI=1S/2C2H5NS2.Ni/c2*1-3-2(4)5;/h2*1H3,(H2,3,4,5);/q;;+2/p-2 |
| InChIKey | VSMIONIIXZFBFZ-UHFFFAOYSA-L |
| XLogP | 0.07 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 271.08 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|
Analyze bis(N-methylcarbamodithioate);nickel(2+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(N-methylcarbamodithioate);nickel(2+)?
The IUPAC name of bis(N-methylcarbamodithioate);nickel(2+) (CID 4585014) is bis(N-methylcarbamodithioate);nickel(2+).
What is the SMILES notation for bis(N-methylcarbamodithioate);nickel(2+)?
The canonical SMILES for bis(N-methylcarbamodithioate);nickel(2+) is CNC(=S)[S-].CNC(=S)[S-].[Ni+2].
What is the InChIKey of bis(N-methylcarbamodithioate);nickel(2+)?
The InChIKey is VSMIONIIXZFBFZ-UHFFFAOYSA-L. The full InChI is InChI=1S/2C2H5NS2.Ni/c2*1-3-2(4)5;/h2*1H3,(H2,3,4,5);/q;;+2/p-2.
What are the key properties of bis(N-methylcarbamodithioate);nickel(2+)?
bis(N-methylcarbamodithioate);nickel(2+) has a molecular weight of 271.08 g/mol, XLogP of 0.07, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for bis(N-methylcarbamodithioate);nickel(2+) is sourced from PubChem (CID 4585014), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).