C28H32N2O4 — CID 4585122
3-(4-methoxycarbonylphenyl)-3-(2-phenylethylamino)-2-[(2-phenylethylamino)methyl]propanoic acid (PubChem CID 4585122) has the molecular formula C28H32N2O4 and a molecular weight of 460.57 g/mol. Its IUPAC name is 3-(4-methoxycarbonylphenyl)-3-(2-phenylethylamino)-2-[(2-phenylethylamino)methyl]propanoic acid.
| Compound Name | 3-(4-methoxycarbonylphenyl)-3-(2-phenylethylamino)-2-[(2-phenylethylamino)methyl]propanoic acid |
|---|---|
| PubChem CID | 4585122 |
| Molecular Formula | C28H32N2O4 |
| Molecular Weight | 460.57 g/mol |
| Exact Mass | 460.24 |
| IUPAC Name | 3-(4-methoxycarbonylphenyl)-3-(2-phenylethylamino)-2-[(2-phenylethylamino)methyl]propanoic acid |
| SMILES | COC(=O)c1ccc(C(NCCc2ccccc2)C(CNCCc2ccccc2)C(=O)O)cc1 |
| InChI | InChI=1S/C28H32N2O4/c1-34-28(33)24-14-12-23(13-15-24)26(30-19-17-22-10-6-3-7-11-22)25(27(31)32)20-29-18-16-21-8-4-2-5-9-21/h2-15,25-26,29-30H,16-20H2,1H3,(H,31,32) |
| InChIKey | KKIVPHOASYUSAA-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.57 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|