About 7-(benzenesulfonyl)-6,6-dibromobicyclo[3.1.1]heptane
7-(benzenesulfonyl)-6,6-dibromobicyclo[3.1.1]heptane (PubChem CID 4585569) has the molecular formula C13H14Br2O2S
and a molecular weight of 394.13 g/mol. Its IUPAC name is 7-(benzenesulfonyl)-6,6-dibromobicyclo[3.1.1]heptane.
Molecular Properties
| Compound Name | 7-(benzenesulfonyl)-6,6-dibromobicyclo[3.1.1]heptane |
| PubChem CID | 4585569 |
| Molecular Formula | C13H14Br2O2S |
| Molecular Weight | 394.13 g/mol |
| Exact Mass | 391.91 |
| IUPAC Name | 7-(benzenesulfonyl)-6,6-dibromobicyclo[3.1.1]heptane |
| SMILES | O=S(=O)(c1ccccc1)C1C2CCCC1C2(Br)Br |
| InChI | InChI=1S/C13H14Br2O2S/c14-13(15)10-7-4-8-11(13)12(10)18(16,17)9-5-2-1-3-6-9/h1-3,5-6,10-12H,4,7-8H2 |
| InChIKey | IIAPSHKZISHKOG-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 394.13 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 7-(benzenesulfonyl)-6,6-dibromobicyclo[3.1.1]heptane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-(benzenesulfonyl)-6,6-dibromobicyclo[3.1.1]heptane?
The IUPAC name of 7-(benzenesulfonyl)-6,6-dibromobicyclo[3.1.1]heptane (CID 4585569) is 7-(benzenesulfonyl)-6,6-dibromobicyclo[3.1.1]heptane.
What is the SMILES notation for 7-(benzenesulfonyl)-6,6-dibromobicyclo[3.1.1]heptane?
The canonical SMILES for 7-(benzenesulfonyl)-6,6-dibromobicyclo[3.1.1]heptane is O=S(=O)(c1ccccc1)C1C2CCCC1C2(Br)Br.
What is the InChIKey of 7-(benzenesulfonyl)-6,6-dibromobicyclo[3.1.1]heptane?
The InChIKey is IIAPSHKZISHKOG-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14Br2O2S/c14-13(15)10-7-4-8-11(13)12(10)18(16,17)9-5-2-1-3-6-9/h1-3,5-6,10-12H,4,7-8H2.
What are the key properties of 7-(benzenesulfonyl)-6,6-dibromobicyclo[3.1.1]heptane?
7-(benzenesulfonyl)-6,6-dibromobicyclo[3.1.1]heptane has a molecular weight of 394.13 g/mol, XLogP of 3.74, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-(benzenesulfonyl)-6,6-dibromobicyclo[3.1.1]heptane is sourced from PubChem (CID 4585569), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).