About [(1,3,3-trimethyl-2-bicyclo[2.2.1]heptanylidene)amino] 4-tert-butylbenzoate
[(1,3,3-trimethyl-2-bicyclo[2.2.1]heptanylidene)amino] 4-tert-butylbenzoate (PubChem CID 4585590) has the molecular formula C21H29NO2
and a molecular weight of 327.47 g/mol. Its IUPAC name is [(1,3,3-trimethyl-2-bicyclo[2.2.1]heptanylidene)amino] 4-tert-butylbenzoate.
Molecular Properties
| Compound Name | [(1,3,3-trimethyl-2-bicyclo[2.2.1]heptanylidene)amino] 4-tert-butylbenzoate |
| PubChem CID | 4585590 |
| Molecular Formula | C21H29NO2 |
| Molecular Weight | 327.47 g/mol |
| Exact Mass | 327.22 |
| IUPAC Name | [(1,3,3-trimethyl-2-bicyclo[2.2.1]heptanylidene)amino] 4-tert-butylbenzoate |
| SMILES | CC12CCC(C1)C(C)(C)C2=NOC(=O)c1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C21H29NO2/c1-19(2,3)15-9-7-14(8-10-15)17(23)24-22-18-20(4,5)16-11-12-21(18,6)13-16/h7-10,16H,11-13H2,1-6H3 |
| InChIKey | QXORIDJTWWOMPZ-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 327.47 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [(1,3,3-trimethyl-2-bicyclo[2.2.1]heptanylidene)amino] 4-tert-butylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1,3,3-trimethyl-2-bicyclo[2.2.1]heptanylidene)amino] 4-tert-butylbenzoate?
The IUPAC name of [(1,3,3-trimethyl-2-bicyclo[2.2.1]heptanylidene)amino] 4-tert-butylbenzoate (CID 4585590) is [(1,3,3-trimethyl-2-bicyclo[2.2.1]heptanylidene)amino] 4-tert-butylbenzoate.
What is the SMILES notation for [(1,3,3-trimethyl-2-bicyclo[2.2.1]heptanylidene)amino] 4-tert-butylbenzoate?
The canonical SMILES for [(1,3,3-trimethyl-2-bicyclo[2.2.1]heptanylidene)amino] 4-tert-butylbenzoate is CC12CCC(C1)C(C)(C)C2=NOC(=O)c1ccc(C(C)(C)C)cc1.
What is the InChIKey of [(1,3,3-trimethyl-2-bicyclo[2.2.1]heptanylidene)amino] 4-tert-butylbenzoate?
The InChIKey is QXORIDJTWWOMPZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H29NO2/c1-19(2,3)15-9-7-14(8-10-15)17(23)24-22-18-20(4,5)16-11-12-21(18,6)13-16/h7-10,16H,11-13H2,1-6H3.
What are the key properties of [(1,3,3-trimethyl-2-bicyclo[2.2.1]heptanylidene)amino] 4-tert-butylbenzoate?
[(1,3,3-trimethyl-2-bicyclo[2.2.1]heptanylidene)amino] 4-tert-butylbenzoate has a molecular weight of 327.47 g/mol, XLogP of 5.34, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(1,3,3-trimethyl-2-bicyclo[2.2.1]heptanylidene)amino] 4-tert-butylbenzoate is sourced from PubChem (CID 4585590), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).