C19H24N2OS2 — CID 4585984
2-butylsulfanyl-3-(3,5-dimethylphenyl)-6-methyl-6,7-dihydrothieno[3,2-d]pyrimidin-4-one (PubChem CID 4585984) has the molecular formula C19H24N2OS2 and a molecular weight of 360.55 g/mol. Its IUPAC name is 2-butylsulfanyl-3-(3,5-dimethylphenyl)-6-methyl-6,7-dihydrothieno[3,2-d]pyrimidin-4-one.
| Compound Name | 2-butylsulfanyl-3-(3,5-dimethylphenyl)-6-methyl-6,7-dihydrothieno[3,2-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 4585984 |
| Molecular Formula | C19H24N2OS2 |
| Molecular Weight | 360.55 g/mol |
| Exact Mass | 360.13 |
| IUPAC Name | 2-butylsulfanyl-3-(3,5-dimethylphenyl)-6-methyl-6,7-dihydrothieno[3,2-d]pyrimidin-4-one |
| SMILES | CCCCSc1nc2c(c(=O)n1-c1cc(C)cc(C)c1)SC(C)C2 |
| InChI | InChI=1S/C19H24N2OS2/c1-5-6-7-23-19-20-16-11-14(4)24-17(16)18(22)21(19)15-9-12(2)8-13(3)10-15/h8-10,14H,5-7,11H2,1-4H3 |
| InChIKey | DOPHIJTZDHPUEH-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.55 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|