C27H27N3O3S3 — CID 4586300
6-[5-[[3-(4-ethylsulfanylphenyl)-1-phenylpyrazol-4-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]hexanoic acid (PubChem CID 4586300) has the molecular formula C27H27N3O3S3 and a molecular weight of 537.73 g/mol. Its IUPAC name is 6-[5-[[3-(4-ethylsulfanylphenyl)-1-phenylpyrazol-4-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]hexanoic acid.
| Compound Name | 6-[5-[[3-(4-ethylsulfanylphenyl)-1-phenylpyrazol-4-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]hexanoic acid |
|---|---|
| PubChem CID | 4586300 |
| Molecular Formula | C27H27N3O3S3 |
| Molecular Weight | 537.73 g/mol |
| Exact Mass | 537.12 |
| IUPAC Name | 6-[5-[[3-(4-ethylsulfanylphenyl)-1-phenylpyrazol-4-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]hexanoic acid |
| SMILES | CCSc1ccc(-c2nn(-c3ccccc3)cc2C=C2SC(=S)N(CCCCCC(=O)O)C2=O)cc1 |
| InChI | InChI=1S/C27H27N3O3S3/c1-2-35-22-14-12-19(13-15-22)25-20(18-30(28-25)21-9-5-3-6-10-21)17-23-26(33)29(27(34)36-23)16-8-4-7-11-24(31)32/h3,5-6,9-10,12-15,17-18H,2,4,7-8,11,16H2,1H3,(H,31,32) |
| InChIKey | YVJRUUKWSORSIC-UHFFFAOYSA-N |
| XLogP | 6.50 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.73 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|