C15H13ClN4O2 — CID 4586303
N-[(4-chlorophenyl)methoxy]-N'-(3-cyano-4-methoxy-2-pyridinyl)methanimidamide (PubChem CID 4586303) has the molecular formula C15H13ClN4O2 and a molecular weight of 316.75 g/mol. Its IUPAC name is N-[(4-chlorophenyl)methoxy]-N'-(3-cyano-4-methoxy-2-pyridinyl)methanimidamide.
| Compound Name | N-[(4-chlorophenyl)methoxy]-N'-(3-cyano-4-methoxy-2-pyridinyl)methanimidamide |
|---|---|
| PubChem CID | 4586303 |
| Molecular Formula | C15H13ClN4O2 |
| Molecular Weight | 316.75 g/mol |
| Exact Mass | 316.07 |
| IUPAC Name | N-[(4-chlorophenyl)methoxy]-N'-(3-cyano-4-methoxy-2-pyridinyl)methanimidamide |
| SMILES | COc1ccnc(/N=C/NOCc2ccc(Cl)cc2)c1C#N |
| InChI | InChI=1S/C15H13ClN4O2/c1-21-14-6-7-18-15(13(14)8-17)19-10-20-22-9-11-2-4-12(16)5-3-11/h2-7,10H,9H2,1H3,(H,18,19,20) |
| InChIKey | LSGZNFYSHVXPEG-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 79.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.75 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|