About 1-benzyl-3-phenyl-1-(3,3,3-trifluoro-2-hydroxypropyl)urea
1-benzyl-3-phenyl-1-(3,3,3-trifluoro-2-hydroxypropyl)urea (PubChem CID 4586304) has the molecular formula C17H17F3N2O2
and a molecular weight of 338.33 g/mol. Its IUPAC name is 1-benzyl-3-phenyl-1-(3,3,3-trifluoro-2-hydroxypropyl)urea.
Molecular Properties
| Compound Name | 1-benzyl-3-phenyl-1-(3,3,3-trifluoro-2-hydroxypropyl)urea |
| PubChem CID | 4586304 |
| Molecular Formula | C17H17F3N2O2 |
| Molecular Weight | 338.33 g/mol |
| Exact Mass | 338.12 |
| IUPAC Name | 1-benzyl-3-phenyl-1-(3,3,3-trifluoro-2-hydroxypropyl)urea |
| SMILES | O=C(Nc1ccccc1)N(Cc1ccccc1)CC(O)C(F)(F)F |
| InChI | InChI=1S/C17H17F3N2O2/c18-17(19,20)15(23)12-22(11-13-7-3-1-4-8-13)16(24)21-14-9-5-2-6-10-14/h1-10,15,23H,11-12H2,(H,21,24) |
| InChIKey | DSENVSORJPEBJV-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 338.33 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-benzyl-3-phenyl-1-(3,3,3-trifluoro-2-hydroxypropyl)urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-benzyl-3-phenyl-1-(3,3,3-trifluoro-2-hydroxypropyl)urea?
The IUPAC name of 1-benzyl-3-phenyl-1-(3,3,3-trifluoro-2-hydroxypropyl)urea (CID 4586304) is 1-benzyl-3-phenyl-1-(3,3,3-trifluoro-2-hydroxypropyl)urea.
What is the SMILES notation for 1-benzyl-3-phenyl-1-(3,3,3-trifluoro-2-hydroxypropyl)urea?
The canonical SMILES for 1-benzyl-3-phenyl-1-(3,3,3-trifluoro-2-hydroxypropyl)urea is O=C(Nc1ccccc1)N(Cc1ccccc1)CC(O)C(F)(F)F.
What is the InChIKey of 1-benzyl-3-phenyl-1-(3,3,3-trifluoro-2-hydroxypropyl)urea?
The InChIKey is DSENVSORJPEBJV-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H17F3N2O2/c18-17(19,20)15(23)12-22(11-13-7-3-1-4-8-13)16(24)21-14-9-5-2-6-10-14/h1-10,15,23H,11-12H2,(H,21,24).
What are the key properties of 1-benzyl-3-phenyl-1-(3,3,3-trifluoro-2-hydroxypropyl)urea?
1-benzyl-3-phenyl-1-(3,3,3-trifluoro-2-hydroxypropyl)urea has a molecular weight of 338.33 g/mol, XLogP of 3.64, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-benzyl-3-phenyl-1-(3,3,3-trifluoro-2-hydroxypropyl)urea is sourced from PubChem (CID 4586304), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).