C18H18N2O6 — CID 4586919
(3,3,8-trimethyl-1,5-dihydro-[1,3]dioxepino[5,6-c]pyridin-9-yl) 4-nitrobenzoate (PubChem CID 4586919) has the molecular formula C18H18N2O6 and a molecular weight of 358.35 g/mol. Its IUPAC name is (3,3,8-trimethyl-1,5-dihydro-[1,3]dioxepino[5,6-c]pyridin-9-yl) 4-nitrobenzoate.
| Compound Name | (3,3,8-trimethyl-1,5-dihydro-[1,3]dioxepino[5,6-c]pyridin-9-yl) 4-nitrobenzoate |
|---|---|
| PubChem CID | 4586919 |
| Molecular Formula | C18H18N2O6 |
| Molecular Weight | 358.35 g/mol |
| Exact Mass | 358.12 |
| IUPAC Name | (3,3,8-trimethyl-1,5-dihydro-[1,3]dioxepino[5,6-c]pyridin-9-yl) 4-nitrobenzoate |
| SMILES | Cc1ncc2c(c1OC(=O)c1ccc([N+](=O)[O-])cc1)COC(C)(C)OC2 |
| InChI | InChI=1S/C18H18N2O6/c1-11-16(15-10-25-18(2,3)24-9-13(15)8-19-11)26-17(21)12-4-6-14(7-5-12)20(22)23/h4-8H,9-10H2,1-3H3 |
| InChIKey | FBUCNFYRNZPJRX-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 100.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.35 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|