C23H22N6O — CID 4588127
4-phenyldiazenyl-2-[(1,4,5,7-tetramethylpyrrolo[3,4-d]pyridazin-6-yl)iminomethyl]phenol (PubChem CID 4588127) has the molecular formula C23H22N6O and a molecular weight of 398.47 g/mol. Its IUPAC name is 4-phenyldiazenyl-2-[(1,4,5,7-tetramethylpyrrolo[3,4-d]pyridazin-6-yl)iminomethyl]phenol.
| Compound Name | 4-phenyldiazenyl-2-[(1,4,5,7-tetramethylpyrrolo[3,4-d]pyridazin-6-yl)iminomethyl]phenol |
|---|---|
| PubChem CID | 4588127 |
| Molecular Formula | C23H22N6O |
| Molecular Weight | 398.47 g/mol |
| Exact Mass | 398.19 |
| IUPAC Name | 4-phenyldiazenyl-2-[(1,4,5,7-tetramethylpyrrolo[3,4-d]pyridazin-6-yl)iminomethyl]phenol |
| SMILES | Cc1nnc(C)c2c(C)n(N=Cc3cc(/N=N/c4ccccc4)ccc3O)c(C)c12 |
| InChI | InChI=1S/C23H22N6O/c1-14-22-16(3)29(17(4)23(22)15(2)26-25-14)24-13-18-12-20(10-11-21(18)30)28-27-19-8-6-5-7-9-19/h5-13,30H,1-4H3/b24-13?,28-27+ |
| InChIKey | ULYVTNIUEFRVMK-GYPKSUDCSA-N |
| XLogP | 5.67 |
| TPSA | 88.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.47 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|