C24H23N3O5S — CID 4588330
N-(2,3-dihydro-1,4-benzodioxin-5-ylmethylideneamino)-4-[(N-methylsulfonylanilino)methyl]benzamide (PubChem CID 4588330) has the molecular formula C24H23N3O5S and a molecular weight of 465.53 g/mol. Its IUPAC name is N-(2,3-dihydro-1,4-benzodioxin-5-ylmethylideneamino)-4-[(N-methylsulfonylanilino)methyl]benzamide.
| Compound Name | N-(2,3-dihydro-1,4-benzodioxin-5-ylmethylideneamino)-4-[(N-methylsulfonylanilino)methyl]benzamide |
|---|---|
| PubChem CID | 4588330 |
| Molecular Formula | C24H23N3O5S |
| Molecular Weight | 465.53 g/mol |
| Exact Mass | 465.14 |
| IUPAC Name | N-(2,3-dihydro-1,4-benzodioxin-5-ylmethylideneamino)-4-[(N-methylsulfonylanilino)methyl]benzamide |
| SMILES | CS(=O)(=O)N(Cc1ccc(C(=O)NN=Cc2cccc3c2OCCO3)cc1)c1ccccc1 |
| InChI | InChI=1S/C24H23N3O5S/c1-33(29,30)27(21-7-3-2-4-8-21)17-18-10-12-19(13-11-18)24(28)26-25-16-20-6-5-9-22-23(20)32-15-14-31-22/h2-13,16H,14-15,17H2,1H3,(H,26,28) |
| InChIKey | QHONDXDRMFLDDW-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 97.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.53 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|