C20H20N+ — CID 4588350
6-ethenyl-9,9-dimethyl-8,10-dihydronaphtho[1,2-f]isoindol-9-ium (PubChem CID 4588350) has the molecular formula C20H20N+ and a molecular weight of 274.39 g/mol. Its IUPAC name is 6-ethenyl-9,9-dimethyl-8,10-dihydronaphtho[1,2-f]isoindol-9-ium.
| Compound Name | 6-ethenyl-9,9-dimethyl-8,10-dihydronaphtho[1,2-f]isoindol-9-ium |
|---|---|
| PubChem CID | 4588350 |
| Molecular Formula | C20H20N+ |
| Molecular Weight | 274.39 g/mol |
| Exact Mass | 274.16 |
| IUPAC Name | 6-ethenyl-9,9-dimethyl-8,10-dihydronaphtho[1,2-f]isoindol-9-ium |
| SMILES | C=Cc1cc2ccccc2c2cc3c(cc12)C[N+](C)(C)C3 |
| InChI | InChI=1S/C20H20N/c1-4-14-9-15-7-5-6-8-18(15)20-11-17-13-21(2,3)12-16(17)10-19(14)20/h4-11H,1,12-13H2,2-3H3/q+1 |
| InChIKey | ORIVPKVXLDZCRQ-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.39 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|