C15H22N2O3S — CID 4588833
3-cyclohexyl-N-(3-sulfamoylphenyl)propanamide (PubChem CID 4588833) has the molecular formula C15H22N2O3S and a molecular weight of 310.42 g/mol. Its IUPAC name is 3-cyclohexyl-N-(3-sulfamoylphenyl)propanamide.
| Compound Name | 3-cyclohexyl-N-(3-sulfamoylphenyl)propanamide |
|---|---|
| PubChem CID | 4588833 |
| Molecular Formula | C15H22N2O3S |
| Molecular Weight | 310.42 g/mol |
| Exact Mass | 310.14 |
| IUPAC Name | 3-cyclohexyl-N-(3-sulfamoylphenyl)propanamide |
| SMILES | NS(=O)(=O)c1cccc(NC(=O)CCC2CCCCC2)c1 |
| InChI | InChI=1S/C15H22N2O3S/c16-21(19,20)14-8-4-7-13(11-14)17-15(18)10-9-12-5-2-1-3-6-12/h4,7-8,11-12H,1-3,5-6,9-10H2,(H,17,18)(H2,16,19,20) |
| InChIKey | PVCAXQQOTAQQHW-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.42 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |