About 1,2-diphenyl-1,2-bis(trimethylsilyl)hydrazine
1,2-diphenyl-1,2-bis(trimethylsilyl)hydrazine (PubChem CID 4588898) has the molecular formula C18H28N2Si2
and a molecular weight of 328.61 g/mol. Its IUPAC name is 1,2-diphenyl-1,2-bis(trimethylsilyl)hydrazine.
Molecular Properties
| Compound Name | 1,2-diphenyl-1,2-bis(trimethylsilyl)hydrazine |
|---|
| PubChem CID | 4588898 |
|---|
| Molecular Formula | C18H28N2Si2 |
|---|
| Molecular Weight | 328.61 g/mol |
|---|
| Exact Mass | 328.18 |
|---|
| IUPAC Name | 1,2-diphenyl-1,2-bis(trimethylsilyl)hydrazine |
|---|
| SMILES | C[Si](C)(C)N(c1ccccc1)N(c1ccccc1)[Si](C)(C)C |
|---|
| InChI | InChI=1S/C18H28N2Si2/c1-21(2,3)19(17-13-9-7-10-14-17)20(22(4,5)6)18-15-11-8-12-16-18/h7-16H,1-6H3 |
|---|
| InChIKey | KZVGBFZABXRJFE-UHFFFAOYSA-N |
|---|
| XLogP | 5.58 |
|---|
| TPSA | 6.48 Ų |
|---|
| H-Bond Donors | |
|---|
| H-Bond Acceptors | 2 |
|---|
| Rotatable Bonds | 5 |
|---|
| Heavy Atoms | 22 |
|---|
| Complexity | — |
|---|
Lipinski Rule of Five
1 violation
| Rule | Value |
|---|
| MW ≤ 500 | 328.61 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1,2-diphenyl-1,2-bis(trimethylsilyl)hydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2-diphenyl-1,2-bis(trimethylsilyl)hydrazine?
The IUPAC name of 1,2-diphenyl-1,2-bis(trimethylsilyl)hydrazine (CID 4588898) is 1,2-diphenyl-1,2-bis(trimethylsilyl)hydrazine.
What is the SMILES notation for 1,2-diphenyl-1,2-bis(trimethylsilyl)hydrazine?
The canonical SMILES for 1,2-diphenyl-1,2-bis(trimethylsilyl)hydrazine is C[Si](C)(C)N(c1ccccc1)N(c1ccccc1)[Si](C)(C)C.
What is the InChIKey of 1,2-diphenyl-1,2-bis(trimethylsilyl)hydrazine?
The InChIKey is KZVGBFZABXRJFE-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H28N2Si2/c1-21(2,3)19(17-13-9-7-10-14-17)20(22(4,5)6)18-15-11-8-12-16-18/h7-16H,1-6H3.
What are the key properties of 1,2-diphenyl-1,2-bis(trimethylsilyl)hydrazine?
1,2-diphenyl-1,2-bis(trimethylsilyl)hydrazine has a molecular weight of 328.61 g/mol, XLogP of 5.58, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2-diphenyl-1,2-bis(trimethylsilyl)hydrazine is sourced from PubChem (CID 4588898), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).