2,3-bis[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid

C13H24N2O6 — CID 4589031

IUPAC2,3-bis[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid
SMILESCC(C)(C)OC(=O)NCC(NC(=O)OC(C)(C)C)C(=O)O
InChIInChI=1S/C13H24N2O6/c1-12(2,3)20-10(18)14-7-8(9(16)17)15-11(19)21-13(4,5)6/h8H,7H2,1-6H3,(H,14,18)(H,15,19)(H,16,17)
InChIKeyUDZLUXXCXDIIOK-UHFFFAOYSA-N
MW304.34 g/mol
LogP1.49
Rot. Bonds4

About 2,3-bis[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid

2,3-bis[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid (PubChem CID 4589031) has the molecular formula C13H24N2O6 and a molecular weight of 304.34 g/mol. Its IUPAC name is 2,3-bis[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid.

Molecular Properties

Compound Name2,3-bis[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid
PubChem CID4589031
Molecular FormulaC13H24N2O6
Molecular Weight304.34 g/mol
Exact Mass304.16
IUPAC Name2,3-bis[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid
SMILESCC(C)(C)OC(=O)NCC(NC(=O)OC(C)(C)C)C(=O)O
InChIInChI=1S/C13H24N2O6/c1-12(2,3)20-10(18)14-7-8(9(16)17)15-11(19)21-13(4,5)6/h8H,7H2,1-6H3,(H,14,18)(H,15,19)(H,16,17)
InChIKeyUDZLUXXCXDIIOK-UHFFFAOYSA-N
XLogP1.49
TPSA113.96 Ų
H-Bond Donors3
H-Bond Acceptors5
Rotatable Bonds4
Heavy Atoms21
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500304.34
LogP ≤ 51.49
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 105

Analyze 2,3-bis[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2,3-bis[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid?
The IUPAC name of 2,3-bis[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid (CID 4589031) is 2,3-bis[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid.
What is the SMILES notation for 2,3-bis[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid?
The canonical SMILES for 2,3-bis[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid is CC(C)(C)OC(=O)NCC(NC(=O)OC(C)(C)C)C(=O)O.
What is the InChIKey of 2,3-bis[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid?
The InChIKey is UDZLUXXCXDIIOK-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H24N2O6/c1-12(2,3)20-10(18)14-7-8(9(16)17)15-11(19)21-13(4,5)6/h8H,7H2,1-6H3,(H,14,18)(H,15,19)(H,16,17).
What are the key properties of 2,3-bis[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid?
2,3-bis[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid has a molecular weight of 304.34 g/mol, XLogP of 1.49, 4 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-bis[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid is sourced from PubChem (CID 4589031), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).