About (2-phenylphenyl)boronic acid
(2-phenylphenyl)boronic acid (PubChem CID 4589187) has the molecular formula C12H11BO2
and a molecular weight of 198.03 g/mol. Its IUPAC name is (2-phenylphenyl)boronic acid.
Molecular Properties
| Compound Name | (2-phenylphenyl)boronic acid |
| PubChem CID | 4589187 |
| Molecular Formula | C12H11BO2 |
| Molecular Weight | 198.03 g/mol |
| Exact Mass | 198.09 |
| IUPAC Name | (2-phenylphenyl)boronic acid |
| SMILES | OB(O)c1ccccc1-c1ccccc1 |
| InChI | InChI=1S/C12H11BO2/c14-13(15)12-9-5-4-8-11(12)10-6-2-1-3-7-10/h1-9,14-15H |
| InChIKey | HYCYKHYFIWHGEX-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.03 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze (2-phenylphenyl)boronic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-phenylphenyl)boronic acid?
The IUPAC name of (2-phenylphenyl)boronic acid (CID 4589187) is (2-phenylphenyl)boronic acid.
What is the SMILES notation for (2-phenylphenyl)boronic acid?
The canonical SMILES for (2-phenylphenyl)boronic acid is OB(O)c1ccccc1-c1ccccc1.
What is the InChIKey of (2-phenylphenyl)boronic acid?
The InChIKey is HYCYKHYFIWHGEX-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11BO2/c14-13(15)12-9-5-4-8-11(12)10-6-2-1-3-7-10/h1-9,14-15H.
What are the key properties of (2-phenylphenyl)boronic acid?
(2-phenylphenyl)boronic acid has a molecular weight of 198.03 g/mol, XLogP of 1.03, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2-phenylphenyl)boronic acid is sourced from PubChem (CID 4589187), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).