About 6-bromo-N-cyclohexyl-2-(3-fluorophenyl)imidazo[1,2-a]pyridin-3-amine
6-bromo-N-cyclohexyl-2-(3-fluorophenyl)imidazo[1,2-a]pyridin-3-amine (PubChem CID 4589362) has the molecular formula C19H19BrFN3
and a molecular weight of 388.28 g/mol. Its IUPAC name is 6-bromo-N-cyclohexyl-2-(3-fluorophenyl)imidazo[1,2-a]pyridin-3-amine.
Molecular Properties
| Compound Name | 6-bromo-N-cyclohexyl-2-(3-fluorophenyl)imidazo[1,2-a]pyridin-3-amine |
| PubChem CID | 4589362 |
| Molecular Formula | C19H19BrFN3 |
| Molecular Weight | 388.28 g/mol |
| Exact Mass | 387.07 |
| IUPAC Name | 6-bromo-N-cyclohexyl-2-(3-fluorophenyl)imidazo[1,2-a]pyridin-3-amine |
| SMILES | Fc1cccc(-c2nc3ccc(Br)cn3c2NC2CCCCC2)c1 |
| InChI | InChI=1S/C19H19BrFN3/c20-14-9-10-17-23-18(13-5-4-6-15(21)11-13)19(24(17)12-14)22-16-7-2-1-3-8-16/h4-6,9-12,16,22H,1-3,7-8H2 |
| InChIKey | ZFMMNOGPVYDBCF-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 29.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 388.28 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-bromo-N-cyclohexyl-2-(3-fluorophenyl)imidazo[1,2-a]pyridin-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-bromo-N-cyclohexyl-2-(3-fluorophenyl)imidazo[1,2-a]pyridin-3-amine?
The IUPAC name of 6-bromo-N-cyclohexyl-2-(3-fluorophenyl)imidazo[1,2-a]pyridin-3-amine (CID 4589362) is 6-bromo-N-cyclohexyl-2-(3-fluorophenyl)imidazo[1,2-a]pyridin-3-amine.
What is the SMILES notation for 6-bromo-N-cyclohexyl-2-(3-fluorophenyl)imidazo[1,2-a]pyridin-3-amine?
The canonical SMILES for 6-bromo-N-cyclohexyl-2-(3-fluorophenyl)imidazo[1,2-a]pyridin-3-amine is Fc1cccc(-c2nc3ccc(Br)cn3c2NC2CCCCC2)c1.
What is the InChIKey of 6-bromo-N-cyclohexyl-2-(3-fluorophenyl)imidazo[1,2-a]pyridin-3-amine?
The InChIKey is ZFMMNOGPVYDBCF-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H19BrFN3/c20-14-9-10-17-23-18(13-5-4-6-15(21)11-13)19(24(17)12-14)22-16-7-2-1-3-8-16/h4-6,9-12,16,22H,1-3,7-8H2.
What are the key properties of 6-bromo-N-cyclohexyl-2-(3-fluorophenyl)imidazo[1,2-a]pyridin-3-amine?
6-bromo-N-cyclohexyl-2-(3-fluorophenyl)imidazo[1,2-a]pyridin-3-amine has a molecular weight of 388.28 g/mol, XLogP of 5.65, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-bromo-N-cyclohexyl-2-(3-fluorophenyl)imidazo[1,2-a]pyridin-3-amine is sourced from PubChem (CID 4589362), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).