C17H11BrN4O3 — CID 4590979
4-bromo-3-nitro-N,N-dipyridin-2-ylbenzamide (PubChem CID 4590979) has the molecular formula C17H11BrN4O3 and a molecular weight of 399.20 g/mol. Its IUPAC name is 4-bromo-3-nitro-N,N-dipyridin-2-ylbenzamide.
| Compound Name | 4-bromo-3-nitro-N,N-dipyridin-2-ylbenzamide |
|---|---|
| PubChem CID | 4590979 |
| Molecular Formula | C17H11BrN4O3 |
| Molecular Weight | 399.20 g/mol |
| Exact Mass | 398.00 |
| IUPAC Name | 4-bromo-3-nitro-N,N-dipyridin-2-ylbenzamide |
| SMILES | O=C(c1ccc(Br)c([N+](=O)[O-])c1)N(c1ccccn1)c1ccccn1 |
| InChI | InChI=1S/C17H11BrN4O3/c18-13-8-7-12(11-14(13)22(24)25)17(23)21(15-5-1-3-9-19-15)16-6-2-4-10-20-16/h1-11H |
| InChIKey | MFKYVLCEPIOHAA-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 89.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.20 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|