C9H14N4O3 — CID 4591079
N,N-dimethyl-5-nitro-2-propan-2-ylimidazole-1-carboxamide (PubChem CID 4591079) has the molecular formula C9H14N4O3 and a molecular weight of 226.24 g/mol. Its IUPAC name is N,N-dimethyl-5-nitro-2-propan-2-ylimidazole-1-carboxamide.
| Compound Name | N,N-dimethyl-5-nitro-2-propan-2-ylimidazole-1-carboxamide |
|---|---|
| PubChem CID | 4591079 |
| Molecular Formula | C9H14N4O3 |
| Molecular Weight | 226.24 g/mol |
| Exact Mass | 226.11 |
| IUPAC Name | N,N-dimethyl-5-nitro-2-propan-2-ylimidazole-1-carboxamide |
| SMILES | CC(C)c1ncc([N+](=O)[O-])n1C(=O)N(C)C |
| InChI | InChI=1S/C9H14N4O3/c1-6(2)8-10-5-7(13(15)16)12(8)9(14)11(3)4/h5-6H,1-4H3 |
| InChIKey | HPXNJOMTUJIFMW-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 81.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.24 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|