About 1-(benzenesulfonyl)-3,3-dimethylbutan-2-one
1-(benzenesulfonyl)-3,3-dimethylbutan-2-one (PubChem CID 4592745) has the molecular formula C12H16O3S
and a molecular weight of 240.32 g/mol. Its IUPAC name is 1-(benzenesulfonyl)-3,3-dimethylbutan-2-one.
Molecular Properties
| Compound Name | 1-(benzenesulfonyl)-3,3-dimethylbutan-2-one |
| PubChem CID | 4592745 |
| Molecular Formula | C12H16O3S |
| Molecular Weight | 240.32 g/mol |
| Exact Mass | 240.08 |
| IUPAC Name | 1-(benzenesulfonyl)-3,3-dimethylbutan-2-one |
| SMILES | CC(C)(C)C(=O)CS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C12H16O3S/c1-12(2,3)11(13)9-16(14,15)10-7-5-4-6-8-10/h4-8H,9H2,1-3H3 |
| InChIKey | KEXNSQSTQQRAOM-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.32 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-(benzenesulfonyl)-3,3-dimethylbutan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(benzenesulfonyl)-3,3-dimethylbutan-2-one?
The IUPAC name of 1-(benzenesulfonyl)-3,3-dimethylbutan-2-one (CID 4592745) is 1-(benzenesulfonyl)-3,3-dimethylbutan-2-one.
What is the SMILES notation for 1-(benzenesulfonyl)-3,3-dimethylbutan-2-one?
The canonical SMILES for 1-(benzenesulfonyl)-3,3-dimethylbutan-2-one is CC(C)(C)C(=O)CS(=O)(=O)c1ccccc1.
What is the InChIKey of 1-(benzenesulfonyl)-3,3-dimethylbutan-2-one?
The InChIKey is KEXNSQSTQQRAOM-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16O3S/c1-12(2,3)11(13)9-16(14,15)10-7-5-4-6-8-10/h4-8H,9H2,1-3H3.
What are the key properties of 1-(benzenesulfonyl)-3,3-dimethylbutan-2-one?
1-(benzenesulfonyl)-3,3-dimethylbutan-2-one has a molecular weight of 240.32 g/mol, XLogP of 2.08, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(benzenesulfonyl)-3,3-dimethylbutan-2-one is sourced from PubChem (CID 4592745), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).