C26H35N6O3P — CID 4593007
3-(4-ethoxy-2-nitrophenyl)imino-N,N-diethyl-2-methyl-4-(1,3,3-trimethylindol-2-ylidene)-1,2,3λ5-diazaphosphol-3-amine (PubChem CID 4593007) has the molecular formula C26H35N6O3P and a molecular weight of 510.58 g/mol. Its IUPAC name is 3-(4-ethoxy-2-nitrophenyl)imino-N,N-diethyl-2-methyl-4-(1,3,3-trimethylindol-2-ylidene)-1,2,3λ5-diazaphosphol-3-amine.
| Compound Name | 3-(4-ethoxy-2-nitrophenyl)imino-N,N-diethyl-2-methyl-4-(1,3,3-trimethylindol-2-ylidene)-1,2,3λ5-diazaphosphol-3-amine |
|---|---|
| PubChem CID | 4593007 |
| Molecular Formula | C26H35N6O3P |
| Molecular Weight | 510.58 g/mol |
| Exact Mass | 510.25 |
| IUPAC Name | 3-(4-ethoxy-2-nitrophenyl)imino-N,N-diethyl-2-methyl-4-(1,3,3-trimethylindol-2-ylidene)-1,2,3λ5-diazaphosphol-3-amine |
| SMILES | CCOc1ccc(N=P2(N(CC)CC)C(=C3N(C)c4ccccc4C3(C)C)C=NN2C)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C26H35N6O3P/c1-8-31(9-2)36(28-21-16-15-19(35-10-3)17-23(21)32(33)34)24(18-27-30(36)7)25-26(4,5)20-13-11-12-14-22(20)29(25)6/h11-18H,8-10H2,1-7H3 |
| InChIKey | WSYLXTKGAQJFAR-UHFFFAOYSA-N |
| XLogP | 6.57 |
| TPSA | 86.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.58 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|