About 3-[(4-phenyldiazenylanilino)methyl]-1,3-benzothiazole-2-thione
3-[(4-phenyldiazenylanilino)methyl]-1,3-benzothiazole-2-thione (PubChem CID 4593135) has the molecular formula C20H16N4S2
and a molecular weight of 376.51 g/mol. Its IUPAC name is 3-[(4-phenyldiazenylanilino)methyl]-1,3-benzothiazole-2-thione.
Molecular Properties
| Compound Name | 3-[(4-phenyldiazenylanilino)methyl]-1,3-benzothiazole-2-thione |
| PubChem CID | 4593135 |
| Molecular Formula | C20H16N4S2 |
| Molecular Weight | 376.51 g/mol |
| Exact Mass | 376.08 |
| IUPAC Name | 3-[(4-phenyldiazenylanilino)methyl]-1,3-benzothiazole-2-thione |
| SMILES | S=c1sc2ccccc2n1CNc1ccc(/N=N/c2ccccc2)cc1 |
| InChI | InChI=1S/C20H16N4S2/c25-20-24(18-8-4-5-9-19(18)26-20)14-21-15-10-12-17(13-11-15)23-22-16-6-2-1-3-7-16/h1-13,21H,14H2/b23-22+ |
| InChIKey | GBPCHJQFCJHOGC-GHVJWSGMSA-N |
| XLogP | 6.92 |
| TPSA | 41.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 376.51 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 3-[(4-phenyldiazenylanilino)methyl]-1,3-benzothiazole-2-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(4-phenyldiazenylanilino)methyl]-1,3-benzothiazole-2-thione?
The IUPAC name of 3-[(4-phenyldiazenylanilino)methyl]-1,3-benzothiazole-2-thione (CID 4593135) is 3-[(4-phenyldiazenylanilino)methyl]-1,3-benzothiazole-2-thione.
What is the SMILES notation for 3-[(4-phenyldiazenylanilino)methyl]-1,3-benzothiazole-2-thione?
The canonical SMILES for 3-[(4-phenyldiazenylanilino)methyl]-1,3-benzothiazole-2-thione is S=c1sc2ccccc2n1CNc1ccc(/N=N/c2ccccc2)cc1.
What is the InChIKey of 3-[(4-phenyldiazenylanilino)methyl]-1,3-benzothiazole-2-thione?
The InChIKey is GBPCHJQFCJHOGC-GHVJWSGMSA-N. The full InChI is InChI=1S/C20H16N4S2/c25-20-24(18-8-4-5-9-19(18)26-20)14-21-15-10-12-17(13-11-15)23-22-16-6-2-1-3-7-16/h1-13,21H,14H2/b23-22+.
What are the key properties of 3-[(4-phenyldiazenylanilino)methyl]-1,3-benzothiazole-2-thione?
3-[(4-phenyldiazenylanilino)methyl]-1,3-benzothiazole-2-thione has a molecular weight of 376.51 g/mol, XLogP of 6.92, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(4-phenyldiazenylanilino)methyl]-1,3-benzothiazole-2-thione is sourced from PubChem (CID 4593135), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).