About 2-pyrrol-1-ylbutanedioic acid
2-pyrrol-1-ylbutanedioic acid (PubChem CID 4593160) has the molecular formula C8H9NO4
and a molecular weight of 183.16 g/mol. Its IUPAC name is 2-pyrrol-1-ylbutanedioic acid.
Molecular Properties
| Compound Name | 2-pyrrol-1-ylbutanedioic acid |
| PubChem CID | 4593160 |
| Molecular Formula | C8H9NO4 |
| Molecular Weight | 183.16 g/mol |
| Exact Mass | 183.05 |
| IUPAC Name | 2-pyrrol-1-ylbutanedioic acid |
| SMILES | O=C(O)CC(C(=O)O)n1cccc1 |
| InChI | InChI=1S/C8H9NO4/c10-7(11)5-6(8(12)13)9-3-1-2-4-9/h1-4,6H,5H2,(H,10,11)(H,12,13) |
| InChIKey | PISYHMUCMYIFRI-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 79.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.16 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-pyrrol-1-ylbutanedioic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-pyrrol-1-ylbutanedioic acid?
The IUPAC name of 2-pyrrol-1-ylbutanedioic acid (CID 4593160) is 2-pyrrol-1-ylbutanedioic acid.
What is the SMILES notation for 2-pyrrol-1-ylbutanedioic acid?
The canonical SMILES for 2-pyrrol-1-ylbutanedioic acid is O=C(O)CC(C(=O)O)n1cccc1.
What is the InChIKey of 2-pyrrol-1-ylbutanedioic acid?
The InChIKey is PISYHMUCMYIFRI-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9NO4/c10-7(11)5-6(8(12)13)9-3-1-2-4-9/h1-4,6H,5H2,(H,10,11)(H,12,13).
What are the key properties of 2-pyrrol-1-ylbutanedioic acid?
2-pyrrol-1-ylbutanedioic acid has a molecular weight of 183.16 g/mol, XLogP of 0.59, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-pyrrol-1-ylbutanedioic acid is sourced from PubChem (CID 4593160), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).