About 5-methyl-3,3a,4,9b-tetrahydro-2H-furo[3,2-c]quinoline
5-methyl-3,3a,4,9b-tetrahydro-2H-furo[3,2-c]quinoline (PubChem CID 4594013) has the molecular formula C12H15NO
and a molecular weight of 189.26 g/mol. Its IUPAC name is 5-methyl-3,3a,4,9b-tetrahydro-2H-furo[3,2-c]quinoline.
Analyze 5-methyl-3,3a,4,9b-tetrahydro-2H-furo[3,2-c]quinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methyl-3,3a,4,9b-tetrahydro-2H-furo[3,2-c]quinoline?
The IUPAC name of 5-methyl-3,3a,4,9b-tetrahydro-2H-furo[3,2-c]quinoline (CID 4594013) is 5-methyl-3,3a,4,9b-tetrahydro-2H-furo[3,2-c]quinoline.
What is the SMILES notation for 5-methyl-3,3a,4,9b-tetrahydro-2H-furo[3,2-c]quinoline?
The canonical SMILES for 5-methyl-3,3a,4,9b-tetrahydro-2H-furo[3,2-c]quinoline is CN1CC2CCOC2c2ccccc21.
What is the InChIKey of 5-methyl-3,3a,4,9b-tetrahydro-2H-furo[3,2-c]quinoline?
The InChIKey is LSYUAYHPEJDMHP-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15NO/c1-13-8-9-6-7-14-12(9)10-4-2-3-5-11(10)13/h2-5,9,12H,6-8H2,1H3.
What are the key properties of 5-methyl-3,3a,4,9b-tetrahydro-2H-furo[3,2-c]quinoline?
5-methyl-3,3a,4,9b-tetrahydro-2H-furo[3,2-c]quinoline has a molecular weight of 189.26 g/mol, XLogP of 2.21, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methyl-3,3a,4,9b-tetrahydro-2H-furo[3,2-c]quinoline is sourced from PubChem (CID 4594013), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).