C18H22O — CID 4594375
13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-one (PubChem CID 4594375) has the molecular formula C18H22O and a molecular weight of 254.37 g/mol. Its IUPAC name is 13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-one.
| Compound Name | 13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-one |
|---|---|
| PubChem CID | 4594375 |
| Molecular Formula | C18H22O |
| Molecular Weight | 254.37 g/mol |
| Exact Mass | 254.17 |
| IUPAC Name | 13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-one |
| SMILES | CC12CCC3c4ccccc4CCC3C1CCC2=O |
| InChI | InChI=1S/C18H22O/c1-18-11-10-14-13-5-3-2-4-12(13)6-7-15(14)16(18)8-9-17(18)19/h2-5,14-16H,6-11H2,1H3 |
| InChIKey | LGHBWDKMGOIZKH-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.37 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |