C22H28N4O6 — CID 4594562
2-[[1-[2-amino-3-(1H-indol-3-yl)propanoyl]piperidine-4-carbonyl]amino]pentanedioic acid (PubChem CID 4594562) has the molecular formula C22H28N4O6 and a molecular weight of 444.49 g/mol. Its IUPAC name is 2-[[1-[2-amino-3-(1H-indol-3-yl)propanoyl]piperidine-4-carbonyl]amino]pentanedioic acid.
| Compound Name | 2-[[1-[2-amino-3-(1H-indol-3-yl)propanoyl]piperidine-4-carbonyl]amino]pentanedioic acid |
|---|---|
| PubChem CID | 4594562 |
| Molecular Formula | C22H28N4O6 |
| Molecular Weight | 444.49 g/mol |
| Exact Mass | 444.20 |
| IUPAC Name | 2-[[1-[2-amino-3-(1H-indol-3-yl)propanoyl]piperidine-4-carbonyl]amino]pentanedioic acid |
| SMILES | NC(Cc1c[nH]c2ccccc12)C(=O)N1CCC(C(=O)NC(CCC(=O)O)C(=O)O)CC1 |
| InChI | InChI=1S/C22H28N4O6/c23-16(11-14-12-24-17-4-2-1-3-15(14)17)21(30)26-9-7-13(8-10-26)20(29)25-18(22(31)32)5-6-19(27)28/h1-4,12-13,16,18,24H,5-11,23H2,(H,25,29)(H,27,28)(H,31,32) |
| InChIKey | HLRNKNWIWDVDDM-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 165.82 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.49 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |