C18H22N2O4S — CID 4595024
5-[(2,4-dimethoxyphenyl)methylidene]-1-methyl-3-(oxolan-2-ylmethyl)-2-sulfanylideneimidazolidin-4-one (PubChem CID 4595024) has the molecular formula C18H22N2O4S and a molecular weight of 362.45 g/mol. Its IUPAC name is 5-[(2,4-dimethoxyphenyl)methylidene]-1-methyl-3-(oxolan-2-ylmethyl)-2-sulfanylideneimidazolidin-4-one.
| Compound Name | 5-[(2,4-dimethoxyphenyl)methylidene]-1-methyl-3-(oxolan-2-ylmethyl)-2-sulfanylideneimidazolidin-4-one |
|---|---|
| PubChem CID | 4595024 |
| Molecular Formula | C18H22N2O4S |
| Molecular Weight | 362.45 g/mol |
| Exact Mass | 362.13 |
| IUPAC Name | 5-[(2,4-dimethoxyphenyl)methylidene]-1-methyl-3-(oxolan-2-ylmethyl)-2-sulfanylideneimidazolidin-4-one |
| SMILES | COc1ccc(C=C2C(=O)N(CC3CCCO3)C(=S)N2C)c(OC)c1 |
| InChI | InChI=1S/C18H22N2O4S/c1-19-15(9-12-6-7-13(22-2)10-16(12)23-3)17(21)20(18(19)25)11-14-5-4-8-24-14/h6-7,9-10,14H,4-5,8,11H2,1-3H3 |
| InChIKey | KDKDUATVJYPCIV-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 51.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.45 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|